C15H14BrNO3S2 — CID 55755588
ethyl 2-[(3-bromothiophene-2-carbonyl)amino]-4-cyclopropylthiophene-3-carboxylate (PubChem CID 55755588) has the molecular formula C15H14BrNO3S2 and a molecular weight of 400.32 g/mol. Its IUPAC name is ethyl 2-[(3-bromothiophene-2-carbonyl)amino]-4-cyclopropylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3-bromothiophene-2-carbonyl)amino]-4-cyclopropylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 55755588 |
| Molecular Formula | C15H14BrNO3S2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | ethyl 2-[(3-bromothiophene-2-carbonyl)amino]-4-cyclopropylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2CC2)csc1NC(=O)c1sccc1Br |
| InChI | InChI=1S/C15H14BrNO3S2/c1-2-20-15(19)11-9(8-3-4-8)7-22-14(11)17-13(18)12-10(16)5-6-21-12/h5-8H,2-4H2,1H3,(H,17,18) |
| InChIKey | NSMKINNFOPEQHR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |