C15H20BrNO3S — CID 103601671
ethyl 2-(5-bromopentanoylamino)-4-cyclopropylthiophene-3-carboxylate (PubChem CID 103601671) has the molecular formula C15H20BrNO3S and a molecular weight of 374.30 g/mol. Its IUPAC name is ethyl 2-(5-bromopentanoylamino)-4-cyclopropylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(5-bromopentanoylamino)-4-cyclopropylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 103601671 |
| Molecular Formula | C15H20BrNO3S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | ethyl 2-(5-bromopentanoylamino)-4-cyclopropylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2CC2)csc1NC(=O)CCCCBr |
| InChI | InChI=1S/C15H20BrNO3S/c1-2-20-15(19)13-11(10-6-7-10)9-21-14(13)17-12(18)5-3-4-8-16/h9-10H,2-8H2,1H3,(H,17,18) |
| InChIKey | ZCNCNOOSKWAZOV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|