C19H20ClNO3S2 — CID 18274324
ethyl 2-[3-(4-chlorophenyl)sulfanylpropanoylamino]-4-cyclopropylthiophene-3-carboxylate (PubChem CID 18274324) has the molecular formula C19H20ClNO3S2 and a molecular weight of 409.96 g/mol. Its IUPAC name is ethyl 2-[3-(4-chlorophenyl)sulfanylpropanoylamino]-4-cyclopropylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-chlorophenyl)sulfanylpropanoylamino]-4-cyclopropylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 18274324 |
| Molecular Formula | C19H20ClNO3S2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | ethyl 2-[3-(4-chlorophenyl)sulfanylpropanoylamino]-4-cyclopropylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2CC2)csc1NC(=O)CCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO3S2/c1-2-24-19(23)17-15(12-3-4-12)11-26-18(17)21-16(22)9-10-25-14-7-5-13(20)6-8-14/h5-8,11-12H,2-4,9-10H2,1H3,(H,21,22) |
| InChIKey | QYEAWJLYVBNPEK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |