C19H18FNO5S — CID 2627168
ethyl 4-cyclopropyl-2-[[2-(4-fluorobenzoyl)oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 2627168) has the molecular formula C19H18FNO5S and a molecular weight of 391.42 g/mol. Its IUPAC name is ethyl 4-cyclopropyl-2-[[2-(4-fluorobenzoyl)oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-cyclopropyl-2-[[2-(4-fluorobenzoyl)oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2627168 |
| Molecular Formula | C19H18FNO5S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | ethyl 4-cyclopropyl-2-[[2-(4-fluorobenzoyl)oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2CC2)csc1NC(=O)COC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FNO5S/c1-2-25-19(24)16-14(11-3-4-11)10-27-17(16)21-15(22)9-26-18(23)12-5-7-13(20)8-6-12/h5-8,10-11H,2-4,9H2,1H3,(H,21,22) |
| InChIKey | CQCHXDUCESEMFL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |