C19H23NO5S — CID 9065788
ethyl 2-[[2-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]oxyacetyl]amino]-4-cyclopropylthiophene-3-carboxylate (PubChem CID 9065788) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is ethyl 2-[[2-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]oxyacetyl]amino]-4-cyclopropylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]oxyacetyl]amino]-4-cyclopropylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 9065788 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | ethyl 2-[[2-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]oxyacetyl]amino]-4-cyclopropylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2CC2)csc1NC(=O)COC(=O)C[C@@H]1C=CCC1 |
| InChI | InChI=1S/C19H23NO5S/c1-2-24-19(23)17-14(13-7-8-13)11-26-18(17)20-15(21)10-25-16(22)9-12-5-3-4-6-12/h3,5,11-13H,2,4,6-10H2,1H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | YJSUOXHPOUPZGT-GFCCVEGCSA-N |
| XLogP | 3.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|