C16H16N4O4S2 — CID 121467000
ethyl N-[2-[(2-sulfanyl-2,3-dihydro-1H-benzimidazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 121467000) has the molecular formula C16H16N4O4S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is ethyl N-[2-[(2-sulfanyl-2,3-dihydro-1H-benzimidazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[(2-sulfanyl-2,3-dihydro-1H-benzimidazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 121467000 |
| Molecular Formula | C16H16N4O4S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | ethyl N-[2-[(2-sulfanyl-2,3-dihydro-1H-benzimidazole-5-carbonyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)c1ccc2c(c1)NC(S)N2 |
| InChI | InChI=1S/C16H16N4O4S2/c1-2-24-16(23)20-13(22)9-5-6-26-14(9)19-12(21)8-3-4-10-11(7-8)18-15(25)17-10/h3-7,15,17-18,25H,2H2,1H3,(H,19,21)(H,20,22,23) |
| InChIKey | JSRVZPVMFBYTCT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|