C17H13ClN2O4S2 — CID 121464946
ethyl N-[2-[(6-chloro-1-benzothiophene-2-carbonyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 121464946) has the molecular formula C17H13ClN2O4S2 and a molecular weight of 408.89 g/mol. Its IUPAC name is ethyl N-[2-[(6-chloro-1-benzothiophene-2-carbonyl)amino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[(6-chloro-1-benzothiophene-2-carbonyl)amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 121464946 |
| Molecular Formula | C17H13ClN2O4S2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | ethyl N-[2-[(6-chloro-1-benzothiophene-2-carbonyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)c1cc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C17H13ClN2O4S2/c1-2-24-17(23)20-14(21)11-5-6-25-16(11)19-15(22)13-7-9-3-4-10(18)8-12(9)26-13/h3-8H,2H2,1H3,(H,19,22)(H,20,21,23) |
| InChIKey | UCFCMAMUIHNHKG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |