C15H11ClN4O4S2 — CID 121464885
ethyl N-[2-[(6-chloro-[1,3]thiazolo[4,5-c]pyridine-2-carbonyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 121464885) has the molecular formula C15H11ClN4O4S2 and a molecular weight of 410.86 g/mol. Its IUPAC name is ethyl N-[2-[(6-chloro-[1,3]thiazolo[4,5-c]pyridine-2-carbonyl)amino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[(6-chloro-[1,3]thiazolo[4,5-c]pyridine-2-carbonyl)amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 121464885 |
| Molecular Formula | C15H11ClN4O4S2 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | ethyl N-[2-[(6-chloro-[1,3]thiazolo[4,5-c]pyridine-2-carbonyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)c1nc2cnc(Cl)cc2s1 |
| InChI | InChI=1S/C15H11ClN4O4S2/c1-2-24-15(23)20-11(21)7-3-4-25-13(7)19-12(22)14-18-8-6-17-10(16)5-9(8)26-14/h3-6H,2H2,1H3,(H,19,22)(H,20,21,23) |
| InChIKey | DJZFOUTVTZHNOD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|