C22H25FeN2O3PS+2 — CID 71477733
CID 71477733 (PubChem CID 71477733) has the molecular formula C22H25FeN2O3PS+2 and a molecular weight of 484.34 g/mol.
| Compound Name | CID 71477733 |
|---|---|
| PubChem CID | 71477733 |
| Molecular Formula | C22H25FeN2O3PS+2 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | — |
| SMILES | CCOP(=O)(OCC)C(Nc1nc2ccccc2s1)[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C17H20N2O3PS.C5H5.Fe/c1-3-21-23(20,22-4-2)16(13-9-5-6-10-13)19-17-18-14-11-7-8-12-15(14)24-17;1-2-4-5-3-1;/h5-12,16H,3-4H2,1-2H3,(H,18,19);1-5H;/q;;+2 |
| InChIKey | XCSIFSSXYIOIFD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|