C18H14N4OS — CID 91680673
N-(2-hydrazinyl-1,3-benzothiazol-6-yl)naphthalene-1-carboxamide (PubChem CID 91680673) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(2-hydrazinyl-1,3-benzothiazol-6-yl)naphthalene-1-carboxamide.
| Compound Name | N-(2-hydrazinyl-1,3-benzothiazol-6-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 91680673 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-(2-hydrazinyl-1,3-benzothiazol-6-yl)naphthalene-1-carboxamide |
| SMILES | NNc1nc2ccc(NC(=O)c3cccc4ccccc34)cc2s1 |
| InChI | InChI=1S/C18H14N4OS/c19-22-18-21-15-9-8-12(10-16(15)24-18)20-17(23)14-7-3-5-11-4-1-2-6-13(11)14/h1-10H,19H2,(H,20,23)(H,21,22) |
| InChIKey | HVMCNFXIZHNYHA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|