C24H23Cl3N2O3 — CID 3103402
butyl 4-[[2,2,2-trichloro-1-(naphthalene-1-carbonylamino)ethyl]amino]benzoate (PubChem CID 3103402) has the molecular formula C24H23Cl3N2O3 and a molecular weight of 493.82 g/mol. Its IUPAC name is butyl 4-[[2,2,2-trichloro-1-(naphthalene-1-carbonylamino)ethyl]amino]benzoate.
| Compound Name | butyl 4-[[2,2,2-trichloro-1-(naphthalene-1-carbonylamino)ethyl]amino]benzoate |
|---|---|
| PubChem CID | 3103402 |
| Molecular Formula | C24H23Cl3N2O3 |
| Molecular Weight | 493.82 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | butyl 4-[[2,2,2-trichloro-1-(naphthalene-1-carbonylamino)ethyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(NC(=O)c2cccc3ccccc23)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C24H23Cl3N2O3/c1-2-3-15-32-22(31)17-11-13-18(14-12-17)28-23(24(25,26)27)29-21(30)20-10-6-8-16-7-4-5-9-19(16)20/h4-14,23,28H,2-3,15H2,1H3,(H,29,30) |
| InChIKey | OGJOANPWVUBARG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.82 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|