C20H29Cl3N2O3 — CID 4613773
methyl 4-[[2,2,2-trichloro-1-(decanoylamino)ethyl]amino]benzoate (PubChem CID 4613773) has the molecular formula C20H29Cl3N2O3 and a molecular weight of 451.82 g/mol. Its IUPAC name is methyl 4-[[2,2,2-trichloro-1-(decanoylamino)ethyl]amino]benzoate.
| Compound Name | methyl 4-[[2,2,2-trichloro-1-(decanoylamino)ethyl]amino]benzoate |
|---|---|
| PubChem CID | 4613773 |
| Molecular Formula | C20H29Cl3N2O3 |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | methyl 4-[[2,2,2-trichloro-1-(decanoylamino)ethyl]amino]benzoate |
| SMILES | CCCCCCCCCC(=O)NC(Nc1ccc(C(=O)OC)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H29Cl3N2O3/c1-3-4-5-6-7-8-9-10-17(26)25-19(20(21,22)23)24-16-13-11-15(12-14-16)18(27)28-2/h11-14,19,24H,3-10H2,1-2H3,(H,25,26) |
| InChIKey | CWIBVKVLHSKXFR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|