C16H22Cl4N2O — CID 3145489
N-[2,2,2-trichloro-1-(3-chloroanilino)ethyl]octanamide (PubChem CID 3145489) has the molecular formula C16H22Cl4N2O and a molecular weight of 400.18 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(3-chloroanilino)ethyl]octanamide.
| Compound Name | N-[2,2,2-trichloro-1-(3-chloroanilino)ethyl]octanamide |
|---|---|
| PubChem CID | 3145489 |
| Molecular Formula | C16H22Cl4N2O |
| Molecular Weight | 400.18 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N-[2,2,2-trichloro-1-(3-chloroanilino)ethyl]octanamide |
| SMILES | CCCCCCCC(=O)NC(Nc1cccc(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H22Cl4N2O/c1-2-3-4-5-6-10-14(23)22-15(16(18,19)20)21-13-9-7-8-12(17)11-13/h7-9,11,15,21H,2-6,10H2,1H3,(H,22,23) |
| InChIKey | CIFNFCHENGSWQP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.18 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|