C15H17Cl4F3N2O — CID 3628002
N-[2,2,2-trichloro-1-[5-chloro-2-(trifluoromethyl)anilino]ethyl]hexanamide (PubChem CID 3628002) has the molecular formula C15H17Cl4F3N2O and a molecular weight of 440.12 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[5-chloro-2-(trifluoromethyl)anilino]ethyl]hexanamide.
| Compound Name | N-[2,2,2-trichloro-1-[5-chloro-2-(trifluoromethyl)anilino]ethyl]hexanamide |
|---|---|
| PubChem CID | 3628002 |
| Molecular Formula | C15H17Cl4F3N2O |
| Molecular Weight | 440.12 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | N-[2,2,2-trichloro-1-[5-chloro-2-(trifluoromethyl)anilino]ethyl]hexanamide |
| SMILES | CCCCCC(=O)NC(Nc1cc(Cl)ccc1C(F)(F)F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H17Cl4F3N2O/c1-2-3-4-5-12(25)24-13(14(17,18)19)23-11-8-9(16)6-7-10(11)15(20,21)22/h6-8,13,23H,2-5H2,1H3,(H,24,25) |
| InChIKey | MJKKRTCKPGXPPG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.12 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|