C20H22N4O2S — CID 36556620
N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-5-(carbamoylamino)pentanamide (PubChem CID 36556620) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-5-(carbamoylamino)pentanamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-5-(carbamoylamino)pentanamide |
|---|---|
| PubChem CID | 36556620 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-5-(carbamoylamino)pentanamide |
| SMILES | NC(=O)NCCCCC(=O)Nc1ccc(Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H22N4O2S/c21-20(26)22-12-4-3-7-18(25)23-15-10-8-14(9-11-15)13-19-24-16-5-1-2-6-17(16)27-19/h1-2,5-6,8-11H,3-4,7,12-13H2,(H,23,25)(H3,21,22,26) |
| InChIKey | HSNHKSZBIXDKCY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|