C19H21N3O2S — CID 120587004
4-amino-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-methoxybutanamide (PubChem CID 120587004) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-amino-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 120587004 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-amino-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-methoxybutanamide |
| SMILES | COC(CN)CC(=O)Nc1ccc(Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H21N3O2S/c1-24-15(12-20)11-18(23)21-14-8-6-13(7-9-14)10-19-22-16-4-2-3-5-17(16)25-19/h2-9,15H,10-12,20H2,1H3,(H,21,23) |
| InChIKey | JCXQZRRWNJBYFR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |