C19H21NO3S — CID 146625397
7-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbaldehyde (PubChem CID 146625397) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 7-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbaldehyde.
| Compound Name | 7-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbaldehyde |
|---|---|
| PubChem CID | 146625397 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 7-[2-[4-(diethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbaldehyde |
| SMILES | CCN(CC)c1ccc(C=Cc2sc(C=O)c3c2OCCO3)cc1 |
| InChI | InChI=1S/C19H21NO3S/c1-3-20(4-2)15-8-5-14(6-9-15)7-10-16-18-19(17(13-21)24-16)23-12-11-22-18/h5-10,13H,3-4,11-12H2,1-2H3 |
| InChIKey | QKKKDAKOYJWAKS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|