C26H26IN3O2S — CID 11421746
N-ethyl-N-[[4-[(E)-2-[5-[(E)-2-(4-iodophenyl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]ethenyl]phenyl]diazenyl]ethanamine (PubChem CID 11421746) has the molecular formula C26H26IN3O2S and a molecular weight of 571.48 g/mol. Its IUPAC name is N-ethyl-N-[[4-[(E)-2-[5-[(E)-2-(4-iodophenyl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]ethenyl]phenyl]diazenyl]ethanamine.
| Compound Name | N-ethyl-N-[[4-[(E)-2-[5-[(E)-2-(4-iodophenyl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]ethenyl]phenyl]diazenyl]ethanamine |
|---|---|
| PubChem CID | 11421746 |
| Molecular Formula | C26H26IN3O2S |
| Molecular Weight | 571.48 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | N-ethyl-N-[[4-[(E)-2-[5-[(E)-2-(4-iodophenyl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]ethenyl]phenyl]diazenyl]ethanamine |
| SMILES | CCN(CC)/N=N/c1ccc(/C=C/c2sc(/C=C/c3ccc(I)cc3)c3c2OCCO3)cc1 |
| InChI | InChI=1S/C26H26IN3O2S/c1-3-30(4-2)29-28-22-13-7-20(8-14-22)10-16-24-26-25(31-17-18-32-26)23(33-24)15-9-19-5-11-21(27)12-6-19/h5-16H,3-4,17-18H2,1-2H3/b15-9+,16-10+,29-28+ |
| InChIKey | BPJATFQYOBRWFX-HOLBMUDDSA-N |
| XLogP | 7.81 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.48 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|