C27H26N2O2S2 — CID 72636530
N-[[7-[2-(4-prop-1-enylphenyl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylideneamino]-N-(thiiran-2-ylmethyl)aniline (PubChem CID 72636530) has the molecular formula C27H26N2O2S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-[[7-[2-(4-prop-1-enylphenyl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylideneamino]-N-(thiiran-2-ylmethyl)aniline.
| Compound Name | N-[[7-[2-(4-prop-1-enylphenyl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylideneamino]-N-(thiiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 72636530 |
| Molecular Formula | C27H26N2O2S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[[7-[2-(4-prop-1-enylphenyl)ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylideneamino]-N-(thiiran-2-ylmethyl)aniline |
| SMILES | CC=Cc1ccc(C=Cc2sc(C=NN(CC3CS3)c3ccccc3)c3c2OCCO3)cc1 |
| InChI | InChI=1S/C27H26N2O2S2/c1-2-6-20-9-11-21(12-10-20)13-14-24-26-27(31-16-15-30-26)25(33-24)17-28-29(18-23-19-32-23)22-7-4-3-5-8-22/h2-14,17,23H,15-16,18-19H2,1H3 |
| InChIKey | FYILEWLBWQPWPL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|