C32H21N5O2S — CID 11027931
2-[3-(dicyanomethylidene)-2-[[7-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylidene]inden-1-ylidene]propanedinitrile (PubChem CID 11027931) has the molecular formula C32H21N5O2S and a molecular weight of 539.62 g/mol. Its IUPAC name is 2-[3-(dicyanomethylidene)-2-[[7-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylidene]inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[3-(dicyanomethylidene)-2-[[7-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylidene]inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 11027931 |
| Molecular Formula | C32H21N5O2S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 2-[3-(dicyanomethylidene)-2-[[7-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylidene]inden-1-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(/C=C/c2sc(C=C3C(=C(C#N)C#N)c4ccccc4C3=C(C#N)C#N)c3c2OCCO3)cc1 |
| InChI | InChI=1S/C32H21N5O2S/c1-37(2)23-10-7-20(8-11-23)9-12-27-31-32(39-14-13-38-31)28(40-27)15-26-29(21(16-33)17-34)24-5-3-4-6-25(24)30(26)22(18-35)19-36/h3-12,15H,13-14H2,1-2H3/b12-9+ |
| InChIKey | NPIZKWQQYWAUIE-FMIVXFBMSA-N |
| XLogP | 6.45 |
| TPSA | 116.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|