C29H21N3O3S — CID 11016465
2-[(2Z)-2-[[7-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 11016465) has the molecular formula C29H21N3O3S and a molecular weight of 491.57 g/mol. Its IUPAC name is 2-[(2Z)-2-[[7-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[7-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 11016465 |
| Molecular Formula | C29H21N3O3S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-[(2Z)-2-[[7-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(/C=C/c2sc(/C=C3\C(=O)c4ccccc4C3=C(C#N)C#N)c3c2OCCO3)cc1 |
| InChI | InChI=1S/C29H21N3O3S/c1-32(2)20-10-7-18(8-11-20)9-12-24-28-29(35-14-13-34-28)25(36-24)15-23-26(19(16-30)17-31)21-5-3-4-6-22(21)27(23)33/h3-12,15H,13-14H2,1-2H3/b12-9+,23-15- |
| InChIKey | BGMXDGUVBRBOSK-GSNARSAFSA-N |
| XLogP | 5.84 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|