C13H5IN2O — CID 135210399
2-[(2E)-2-(iodomethylidene)-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 135210399) has the molecular formula C13H5IN2O and a molecular weight of 332.10 g/mol. Its IUPAC name is 2-[(2E)-2-(iodomethylidene)-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2E)-2-(iodomethylidene)-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 135210399 |
| Molecular Formula | C13H5IN2O |
| Molecular Weight | 332.10 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | 2-[(2E)-2-(iodomethylidene)-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C\I)C(=O)c2ccccc21 |
| InChI | InChI=1S/C13H5IN2O/c14-5-11-12(8(6-15)7-16)9-3-1-2-4-10(9)13(11)17/h1-5H/b11-5+ |
| InChIKey | DOVZHIJGJQWYPD-VZUCSPMQSA-N |
| XLogP | 3.00 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.10 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|