C20H16N2OS2 — CID 149372948
2-[(2Z)-2-[[4-methyl-5-(1-sulfanylethenyl)thiolan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 149372948) has the molecular formula C20H16N2OS2 and a molecular weight of 364.50 g/mol. Its IUPAC name is 2-[(2Z)-2-[[4-methyl-5-(1-sulfanylethenyl)thiolan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[4-methyl-5-(1-sulfanylethenyl)thiolan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 149372948 |
| Molecular Formula | C20H16N2OS2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-[(2Z)-2-[[4-methyl-5-(1-sulfanylethenyl)thiolan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | C=C(S)C1SC(/C=C2\C(=O)c3ccccc3C2=C(C#N)C#N)CC1C |
| InChI | InChI=1S/C20H16N2OS2/c1-11-7-14(25-20(11)12(2)24)8-17-18(13(9-21)10-22)15-5-3-4-6-16(15)19(17)23/h3-6,8,11,14,20,24H,2,7H2,1H3/b17-8- |
| InChIKey | YKEAFJLOTXZZQI-IUXPMGMMSA-N |
| XLogP | 4.56 |
| TPSA | 64.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|