C17H10N2O — CID 145410467
2-[2,3-bis(ethenyl)-4-oxonaphthalen-1-ylidene]propanedinitrile (PubChem CID 145410467) has the molecular formula C17H10N2O and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-[2,3-bis(ethenyl)-4-oxonaphthalen-1-ylidene]propanedinitrile.
| Compound Name | 2-[2,3-bis(ethenyl)-4-oxonaphthalen-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 145410467 |
| Molecular Formula | C17H10N2O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-[2,3-bis(ethenyl)-4-oxonaphthalen-1-ylidene]propanedinitrile |
| SMILES | C=CC1=C(C=C)C(=C(C#N)C#N)c2ccccc2C1=O |
| InChI | InChI=1S/C17H10N2O/c1-3-12-13(4-2)17(20)15-8-6-5-7-14(15)16(12)11(9-18)10-19/h3-8H,1-2H2 |
| InChIKey | BUOZBRRPFUMTRH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|