C18H10N2 — CID 13426325
2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propanedinitrile (PubChem CID 13426325) has the molecular formula C18H10N2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propanedinitrile.
| Compound Name | 2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propanedinitrile |
|---|---|
| PubChem CID | 13426325 |
| Molecular Formula | C18H10N2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C18H10N2/c19-11-15(12-20)18-16-7-3-1-5-13(16)9-10-14-6-2-4-8-17(14)18/h1-10H |
| InChIKey | IUXPKWQERWYJAV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|