C28H12N6 — CID 88562756
2-[2,3-bis(4-cyanophenyl)indeno[1,2-b]pyrazin-9-ylidene]propanedinitrile (PubChem CID 88562756) has the molecular formula C28H12N6 and a molecular weight of 432.45 g/mol. Its IUPAC name is 2-[2,3-bis(4-cyanophenyl)indeno[1,2-b]pyrazin-9-ylidene]propanedinitrile.
| Compound Name | 2-[2,3-bis(4-cyanophenyl)indeno[1,2-b]pyrazin-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 88562756 |
| Molecular Formula | C28H12N6 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-[2,3-bis(4-cyanophenyl)indeno[1,2-b]pyrazin-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2ccccc2-c2nc(-c3ccc(C#N)cc3)c(-c3ccc(C#N)cc3)nc21 |
| InChI | InChI=1S/C28H12N6/c29-13-17-5-9-19(10-6-17)25-26(20-11-7-18(14-30)8-12-20)34-28-24(21(15-31)16-32)22-3-1-2-4-23(22)27(28)33-25/h1-12H |
| InChIKey | PIKYMOYYJWNYNJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|