C23H7F3N6 — CID 143691854
9-(dicyanomethylidene)-6-[4-(trifluoromethyl)phenyl]indeno[1,2-b]pyrazine-2,3-dicarbonitrile (PubChem CID 143691854) has the molecular formula C23H7F3N6 and a molecular weight of 424.35 g/mol. Its IUPAC name is 9-(dicyanomethylidene)-6-[4-(trifluoromethyl)phenyl]indeno[1,2-b]pyrazine-2,3-dicarbonitrile.
| Compound Name | 9-(dicyanomethylidene)-6-[4-(trifluoromethyl)phenyl]indeno[1,2-b]pyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 143691854 |
| Molecular Formula | C23H7F3N6 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 9-(dicyanomethylidene)-6-[4-(trifluoromethyl)phenyl]indeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| SMILES | N#CC(C#N)=C1c2ccc(-c3ccc(C(F)(F)F)cc3)cc2-c2nc(C#N)c(C#N)nc21 |
| InChI | InChI=1S/C23H7F3N6/c24-23(25,26)15-4-1-12(2-5-15)13-3-6-16-17(7-13)21-22(20(16)14(8-27)9-28)32-19(11-30)18(10-29)31-21/h1-7H |
| InChIKey | KZWFPZBGPVWERW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|