C26H10N6S — CID 72539976
9-[cyano(isocyano)methylidene]-6-(5-phenylthiophen-2-yl)indeno[1,2-b]pyrazine-2,3-dicarbonitrile (PubChem CID 72539976) has the molecular formula C26H10N6S and a molecular weight of 438.48 g/mol. Its IUPAC name is 9-[cyano(isocyano)methylidene]-6-(5-phenylthiophen-2-yl)indeno[1,2-b]pyrazine-2,3-dicarbonitrile.
| Compound Name | 9-[cyano(isocyano)methylidene]-6-(5-phenylthiophen-2-yl)indeno[1,2-b]pyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 72539976 |
| Molecular Formula | C26H10N6S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 9-[cyano(isocyano)methylidene]-6-(5-phenylthiophen-2-yl)indeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1c2ccc(-c3ccc(-c4ccccc4)s3)cc2-c2nc(C#N)c(C#N)nc21 |
| InChI | InChI=1S/C26H10N6S/c1-30-21(14-29)24-17-8-7-16(23-10-9-22(33-23)15-5-3-2-4-6-15)11-18(17)25-26(24)32-20(13-28)19(12-27)31-25/h2-11H |
| InChIKey | FEWUJLDFGRQSAU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 101.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|