C30H12N6 — CID 172528076
(9E)-9-[cyano(isocyano)methylidene]-7-phenanthren-9-ylindeno[1,2-b]pyrazine-2,3-dicarbonitrile (PubChem CID 172528076) has the molecular formula C30H12N6 and a molecular weight of 456.47 g/mol. Its IUPAC name is (9E)-9-[cyano(isocyano)methylidene]-7-phenanthren-9-ylindeno[1,2-b]pyrazine-2,3-dicarbonitrile.
| Compound Name | (9E)-9-[cyano(isocyano)methylidene]-7-phenanthren-9-ylindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 172528076 |
| Molecular Formula | C30H12N6 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | (9E)-9-[cyano(isocyano)methylidene]-7-phenanthren-9-ylindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\c2cc(-c3cc4ccccc4c4ccccc34)ccc2-c2nc(C#N)c(C#N)nc21 |
| InChI | InChI=1S/C30H12N6/c1-34-27(16-33)28-24-13-18(10-11-22(24)29-30(28)36-26(15-32)25(14-31)35-29)23-12-17-6-2-3-7-19(17)20-8-4-5-9-21(20)23/h2-13H/b28-27+ |
| InChIKey | AUBSSBSQPCAIPZ-BYYHNAKLSA-N |
| XLogP | 6.38 |
| TPSA | 101.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|