C30H12N8 — CID 172528133
(17E)-17-[cyano(isocyano)methylidene]-14-(2-phenylphenyl)-2,4,7,9-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene-5,6-dicarbonitrile (PubChem CID 172528133) has the molecular formula C30H12N8 and a molecular weight of 484.48 g/mol. Its IUPAC name is (17E)-17-[cyano(isocyano)methylidene]-14-(2-phenylphenyl)-2,4,7,9-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene-5,6-dicarbonitrile.
| Compound Name | (17E)-17-[cyano(isocyano)methylidene]-14-(2-phenylphenyl)-2,4,7,9-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 172528133 |
| Molecular Formula | C30H12N8 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | (17E)-17-[cyano(isocyano)methylidene]-14-(2-phenylphenyl)-2,4,7,9-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene-5,6-dicarbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\c2cc(-c3ccccc3-c3ccccc3)ccc2-c2nc3nc(C#N)c(C#N)nc3nc21 |
| InChI | InChI=1S/C30H12N8/c1-34-25(16-33)26-22-13-18(20-10-6-5-9-19(20)17-7-3-2-4-8-17)11-12-21(22)27-28(26)38-30-29(37-27)35-23(14-31)24(15-32)36-30/h2-13H/b26-25+ |
| InChIKey | BGFZDMDNUVPWJB-OCEACIFDSA-N |
| XLogP | 5.68 |
| TPSA | 127.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|