C20H14ClN3 — CID 137424603
4-(2-chloro-5,5-dimethylindeno[1,2-d]pyrimidin-4-yl)benzonitrile (PubChem CID 137424603) has the molecular formula C20H14ClN3 and a molecular weight of 331.81 g/mol. Its IUPAC name is 4-(2-chloro-5,5-dimethylindeno[1,2-d]pyrimidin-4-yl)benzonitrile.
| Compound Name | 4-(2-chloro-5,5-dimethylindeno[1,2-d]pyrimidin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 137424603 |
| Molecular Formula | C20H14ClN3 |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 4-(2-chloro-5,5-dimethylindeno[1,2-d]pyrimidin-4-yl)benzonitrile |
| SMILES | CC1(C)c2ccccc2-c2nc(Cl)nc(-c3ccc(C#N)cc3)c21 |
| InChI | InChI=1S/C20H14ClN3/c1-20(2)15-6-4-3-5-14(15)18-16(20)17(23-19(21)24-18)13-9-7-12(11-22)8-10-13/h3-10H,1-2H3 |
| InChIKey | MAOXSXRAPGEGGB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |