C50H35N3 — CID 155765185
4-[3-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-9,9-dimethylfluoren-4-yl]phenyl]benzonitrile (PubChem CID 155765185) has the molecular formula C50H35N3 and a molecular weight of 677.85 g/mol. Its IUPAC name is 4-[3-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-9,9-dimethylfluoren-4-yl]phenyl]benzonitrile.
| Compound Name | 4-[3-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-9,9-dimethylfluoren-4-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 155765185 |
| Molecular Formula | C50H35N3 |
| Molecular Weight | 677.85 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | 4-[3-[3-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-9,9-dimethylfluoren-4-yl]phenyl]benzonitrile |
| SMILES | CC1(C)c2ccccc2-c2c1ccc(-c1ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc1)c2-c1cccc(-c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C50H35N3/c1-50(2)43-19-10-9-18-42(43)48-44(50)29-28-41(47(48)40-17-11-16-39(30-40)34-22-20-33(32-51)21-23-34)35-24-26-37(27-25-35)46-31-45(36-12-5-3-6-13-36)52-49(53-46)38-14-7-4-8-15-38/h3-31H,1-2H3 |
| InChIKey | MPAHVNCPNADXMV-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.85 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |