C32H16N2 — CID 44518591
2-[3,6-bis(2-phenylethynyl)fluoren-9-ylidene]propanedinitrile (PubChem CID 44518591) has the molecular formula C32H16N2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[3,6-bis(2-phenylethynyl)fluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[3,6-bis(2-phenylethynyl)fluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 44518591 |
| Molecular Formula | C32H16N2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[3,6-bis(2-phenylethynyl)fluoren-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2ccc(C#Cc3ccccc3)cc2-c2cc(C#Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C32H16N2/c33-21-27(22-34)32-28-17-15-25(13-11-23-7-3-1-4-8-23)19-30(28)31-20-26(16-18-29(31)32)14-12-24-9-5-2-6-10-24/h1-10,15-20H |
| InChIKey | CXHBHJPMGNQAAC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|