C33H9N9 — CID 134300922
2-[6-[3,5-dicyano-1-(dicyanomethylidene)inden-2-yl]-2-pyridinyl]-3-(dicyanomethylidene)indene-1,6-dicarbonitrile (PubChem CID 134300922) has the molecular formula C33H9N9 and a molecular weight of 531.50 g/mol. Its IUPAC name is 2-[6-[3,5-dicyano-1-(dicyanomethylidene)inden-2-yl]-2-pyridinyl]-3-(dicyanomethylidene)indene-1,6-dicarbonitrile.
| Compound Name | 2-[6-[3,5-dicyano-1-(dicyanomethylidene)inden-2-yl]-2-pyridinyl]-3-(dicyanomethylidene)indene-1,6-dicarbonitrile |
|---|---|
| PubChem CID | 134300922 |
| Molecular Formula | C33H9N9 |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 2-[6-[3,5-dicyano-1-(dicyanomethylidene)inden-2-yl]-2-pyridinyl]-3-(dicyanomethylidene)indene-1,6-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cccc(C3=C(C#N)c4cc(C#N)ccc4C3=C(C#N)C#N)n2)=C(C#N)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C33H9N9/c34-10-18-4-6-22-24(8-18)26(16-40)32(30(22)20(12-36)13-37)28-2-1-3-29(42-28)33-27(17-41)25-9-19(11-35)5-7-23(25)31(33)21(14-38)15-39/h1-9H |
| InChIKey | BAJJPCJTSVWUQE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 203.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|