C34H6N12 — CID 138739080
6-[1,5-dicyano-3,7-bis(dicyanomethylidene)-6-(4,6-dicyano-2-pyridinyl)-s-indacen-2-yl]pyridine-2,4-dicarbonitrile (PubChem CID 138739080) has the molecular formula C34H6N12 and a molecular weight of 582.51 g/mol. Its IUPAC name is 6-[1,5-dicyano-3,7-bis(dicyanomethylidene)-6-(4,6-dicyano-2-pyridinyl)-s-indacen-2-yl]pyridine-2,4-dicarbonitrile.
| Compound Name | 6-[1,5-dicyano-3,7-bis(dicyanomethylidene)-6-(4,6-dicyano-2-pyridinyl)-s-indacen-2-yl]pyridine-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 138739080 |
| Molecular Formula | C34H6N12 |
| Molecular Weight | 582.51 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | 6-[1,5-dicyano-3,7-bis(dicyanomethylidene)-6-(4,6-dicyano-2-pyridinyl)-s-indacen-2-yl]pyridine-2,4-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2cc(C#N)cc(C#N)n2)=C(C#N)c2cc3c(cc21)C(C#N)=C(c1cc(C#N)cc(C#N)n1)C3=C(C#N)C#N |
| InChI | InChI=1S/C34H6N12/c35-7-17-1-21(13-41)45-29(3-17)33-27(15-43)23-5-26-24(6-25(23)31(33)19(9-37)10-38)28(16-44)34(32(26)20(11-39)12-40)30-4-18(8-36)2-22(14-42)46-30/h1-6H |
| InChIKey | NHFLOLUSYGFFFQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 263.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|