C23H6N6O — CID 142501709
9-(dicyanomethylidene)-20-oxo-11,12-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaene-6,17-dicarbonitrile (PubChem CID 142501709) has the molecular formula C23H6N6O and a molecular weight of 382.34 g/mol. Its IUPAC name is 9-(dicyanomethylidene)-20-oxo-11,12-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaene-6,17-dicarbonitrile.
| Compound Name | 9-(dicyanomethylidene)-20-oxo-11,12-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaene-6,17-dicarbonitrile |
|---|---|
| PubChem CID | 142501709 |
| Molecular Formula | C23H6N6O |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 9-(dicyanomethylidene)-20-oxo-11,12-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,10,12,14(19),15,17-nonaene-6,17-dicarbonitrile |
| SMILES | N#CC(C#N)=C1c2cc(C#N)ccc2-c2c1nnc1c2C(=O)c2cc(C#N)ccc2-1 |
| InChI | InChI=1S/C23H6N6O/c24-7-11-1-3-14-16(5-11)18(13(9-26)10-27)22-19(14)20-21(28-29-22)15-4-2-12(8-25)6-17(15)23(20)30/h1-6H |
| InChIKey | UNXOULMJKLHVJL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 138.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|