C18H6F3N3OS — CID 143578778
2-[6-cyano-10-oxo-2-(trifluoromethyl)thioxanthen-9-ylidene]propanedinitrile (PubChem CID 143578778) has the molecular formula C18H6F3N3OS and a molecular weight of 369.33 g/mol. Its IUPAC name is 2-[6-cyano-10-oxo-2-(trifluoromethyl)thioxanthen-9-ylidene]propanedinitrile.
| Compound Name | 2-[6-cyano-10-oxo-2-(trifluoromethyl)thioxanthen-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 143578778 |
| Molecular Formula | C18H6F3N3OS |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2-[6-cyano-10-oxo-2-(trifluoromethyl)thioxanthen-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(C(F)(F)F)ccc2S(=O)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C18H6F3N3OS/c19-18(20,21)12-2-4-15-14(6-12)17(11(8-23)9-24)13-3-1-10(7-22)5-16(13)26(15)25/h1-6H |
| InChIKey | VWOHCRSIUACJIE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 88.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|