C19H8F3N3O — CID 102141885
4-[5-oxo-3-(trifluoromethyl)indeno[1,2-c]pyridazin-4-yl]benzonitrile (PubChem CID 102141885) has the molecular formula C19H8F3N3O and a molecular weight of 351.29 g/mol. Its IUPAC name is 4-[5-oxo-3-(trifluoromethyl)indeno[1,2-c]pyridazin-4-yl]benzonitrile.
| Compound Name | 4-[5-oxo-3-(trifluoromethyl)indeno[1,2-c]pyridazin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 102141885 |
| Molecular Formula | C19H8F3N3O |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 4-[5-oxo-3-(trifluoromethyl)indeno[1,2-c]pyridazin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c(C(F)(F)F)nnc3c2C(=O)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C19H8F3N3O/c20-19(21,22)18-14(11-7-5-10(9-23)6-8-11)15-16(24-25-18)12-3-1-2-4-13(12)17(15)26/h1-8H |
| InChIKey | HCGOKDCOIHLUMZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|