About 10-oxo-9H-anthracene-2,6-dicarbonitrile
10-oxo-9H-anthracene-2,6-dicarbonitrile (PubChem CID 154632317) has the molecular formula C16H8N2O
and a molecular weight of 244.25 g/mol. Its IUPAC name is 10-oxo-9H-anthracene-2,6-dicarbonitrile.
Molecular Properties
| Compound Name | 10-oxo-9H-anthracene-2,6-dicarbonitrile |
| PubChem CID | 154632317 |
| Molecular Formula | C16H8N2O |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 10-oxo-9H-anthracene-2,6-dicarbonitrile |
| SMILES | N#Cc1ccc2c(c1)Cc1ccc(C#N)cc1C2=O |
| InChI | InChI=1S/C16H8N2O/c17-8-10-2-4-14-13(5-10)7-12-3-1-11(9-18)6-15(12)16(14)19/h1-6H,7H2 |
| InChIKey | FCCNOMXHBUEPLJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-oxo-9H-anthracene-2,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-oxo-9H-anthracene-2,6-dicarbonitrile?
The IUPAC name of 10-oxo-9H-anthracene-2,6-dicarbonitrile (CID 154632317) is 10-oxo-9H-anthracene-2,6-dicarbonitrile.
What is the SMILES notation for 10-oxo-9H-anthracene-2,6-dicarbonitrile?
The canonical SMILES for 10-oxo-9H-anthracene-2,6-dicarbonitrile is N#Cc1ccc2c(c1)Cc1ccc(C#N)cc1C2=O.
What is the InChIKey of 10-oxo-9H-anthracene-2,6-dicarbonitrile?
The InChIKey is FCCNOMXHBUEPLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8N2O/c17-8-10-2-4-14-13(5-10)7-12-3-1-11(9-18)6-15(12)16(14)19/h1-6H,7H2.
What are the key properties of 10-oxo-9H-anthracene-2,6-dicarbonitrile?
10-oxo-9H-anthracene-2,6-dicarbonitrile has a molecular weight of 244.25 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-oxo-9H-anthracene-2,6-dicarbonitrile is sourced from PubChem (CID 154632317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).