C16H8N2O — CID 154632317
10-oxo-9H-anthracene-2,6-dicarbonitrile (PubChem CID 154632317) has the molecular formula C16H8N2O and a molecular weight of 244.25 g/mol. Its IUPAC name is 10-oxo-9H-anthracene-2,6-dicarbonitrile.
| Compound Name | 10-oxo-9H-anthracene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 154632317 |
| Molecular Formula | C16H8N2O |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 10-oxo-9H-anthracene-2,6-dicarbonitrile |
| SMILES | N#Cc1ccc2c(c1)Cc1ccc(C#N)cc1C2=O |
| InChI | InChI=1S/C16H8N2O/c17-8-10-2-4-14-13(5-10)7-12-3-1-11(9-18)6-15(12)16(14)19/h1-6H,7H2 |
| InChIKey | FCCNOMXHBUEPLJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |