C15H11N — CID 141332736
9,10-dihydrophenanthrene-2-carbonitrile (PubChem CID 141332736) has the molecular formula C15H11N and a molecular weight of 205.26 g/mol. Its IUPAC name is 9,10-dihydrophenanthrene-2-carbonitrile.
| Compound Name | 9,10-dihydrophenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 141332736 |
| Molecular Formula | C15H11N |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 9,10-dihydrophenanthrene-2-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CCc1ccccc1-2 |
| InChI | InChI=1S/C15H11N/c16-10-11-5-8-15-13(9-11)7-6-12-3-1-2-4-14(12)15/h1-5,8-9H,6-7H2 |
| InChIKey | CLFNNDMVSJCDLC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |