C16H11N — CID 152766237
tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene-5-carbonitrile (PubChem CID 152766237) has the molecular formula C16H11N and a molecular weight of 217.27 g/mol. Its IUPAC name is tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene-5-carbonitrile.
| Compound Name | tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene-5-carbonitrile |
|---|---|
| PubChem CID | 152766237 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaene-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)Cc1ccccc1C=C2 |
| InChI | InChI=1S/C16H11N/c17-11-12-5-6-14-8-7-13-3-1-2-4-15(13)10-16(14)9-12/h1-9H,10H2 |
| InChIKey | IXHCEQCOYFUMRO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|