About benzo[b][1]benzoxepine-3,8-dicarbonitrile
benzo[b][1]benzoxepine-3,8-dicarbonitrile (PubChem CID 13158315) has the molecular formula C16H8N2O
and a molecular weight of 244.25 g/mol. Its IUPAC name is benzo[b][1]benzoxepine-3,8-dicarbonitrile.
Molecular Properties
| Compound Name | benzo[b][1]benzoxepine-3,8-dicarbonitrile |
| PubChem CID | 13158315 |
| Molecular Formula | C16H8N2O |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | benzo[b][1]benzoxepine-3,8-dicarbonitrile |
| SMILES | N#Cc1ccc2c(c1)C=Cc1cc(C#N)ccc1O2 |
| InChI | InChI=1S/C16H8N2O/c17-9-11-1-5-15-13(7-11)3-4-14-8-12(10-18)2-6-16(14)19-15/h1-8H |
| InChIKey | RWRZGSZTAVXULM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze benzo[b][1]benzoxepine-3,8-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[b][1]benzoxepine-3,8-dicarbonitrile?
The IUPAC name of benzo[b][1]benzoxepine-3,8-dicarbonitrile (CID 13158315) is benzo[b][1]benzoxepine-3,8-dicarbonitrile.
What is the SMILES notation for benzo[b][1]benzoxepine-3,8-dicarbonitrile?
The canonical SMILES for benzo[b][1]benzoxepine-3,8-dicarbonitrile is N#Cc1ccc2c(c1)C=Cc1cc(C#N)ccc1O2.
What is the InChIKey of benzo[b][1]benzoxepine-3,8-dicarbonitrile?
The InChIKey is RWRZGSZTAVXULM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8N2O/c17-9-11-1-5-15-13(7-11)3-4-14-8-12(10-18)2-6-16(14)19-15/h1-8H.
What are the key properties of benzo[b][1]benzoxepine-3,8-dicarbonitrile?
benzo[b][1]benzoxepine-3,8-dicarbonitrile has a molecular weight of 244.25 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[b][1]benzoxepine-3,8-dicarbonitrile is sourced from PubChem (CID 13158315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).