C8H4FNO2 — CID 150465599
2-fluoro-1,3-benzodioxole-5-carbonitrile (PubChem CID 150465599) has the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. Its IUPAC name is 2-fluoro-1,3-benzodioxole-5-carbonitrile.
| Compound Name | 2-fluoro-1,3-benzodioxole-5-carbonitrile |
|---|---|
| PubChem CID | 150465599 |
| Molecular Formula | C8H4FNO2 |
| Molecular Weight | 165.12 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 2-fluoro-1,3-benzodioxole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)OC(F)O2 |
| InChI | InChI=1S/C8H4FNO2/c9-8-11-6-2-1-5(4-10)3-7(6)12-8/h1-3,8H |
| InChIKey | HQRVFSGRCLZMAI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.12 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |