C8H5NOS — CID 117276190
1,3-benzoxathiole-5-carbonitrile (PubChem CID 117276190) has the molecular formula C8H5NOS and a molecular weight of 163.20 g/mol. Its IUPAC name is 1,3-benzoxathiole-5-carbonitrile.
| Compound Name | 1,3-benzoxathiole-5-carbonitrile |
|---|---|
| PubChem CID | 117276190 |
| Molecular Formula | C8H5NOS |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | 1,3-benzoxathiole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)SCO2 |
| InChI | InChI=1S/C8H5NOS/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-3H,5H2 |
| InChIKey | RCAOYLLRZKDPAS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |