C12H15NOS — CID 117316953
[1-(1,3-benzoxathiol-5-yl)cyclobutyl]methanamine (PubChem CID 117316953) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is [1-(1,3-benzoxathiol-5-yl)cyclobutyl]methanamine.
| Compound Name | [1-(1,3-benzoxathiol-5-yl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 117316953 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | [1-(1,3-benzoxathiol-5-yl)cyclobutyl]methanamine |
| SMILES | NCC1(c2ccc3c(c2)SCO3)CCC1 |
| InChI | InChI=1S/C12H15NOS/c13-7-12(4-1-5-12)9-2-3-10-11(6-9)15-8-14-10/h2-3,6H,1,4-5,7-8,13H2 |
| InChIKey | QPNIUFFFUQCALW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |