C15H23N — CID 62899225
[1-(3,4-dimethylphenyl)cyclohexyl]methanamine (PubChem CID 62899225) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is [1-(3,4-dimethylphenyl)cyclohexyl]methanamine.
| Compound Name | [1-(3,4-dimethylphenyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 62899225 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | [1-(3,4-dimethylphenyl)cyclohexyl]methanamine |
| SMILES | Cc1ccc(C2(CN)CCCCC2)cc1C |
| InChI | InChI=1S/C15H23N/c1-12-6-7-14(10-13(12)2)15(11-16)8-4-3-5-9-15/h6-7,10H,3-5,8-9,11,16H2,1-2H3 |
| InChIKey | TVSFYVLGPDYXHR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |