C25H15NO2 — CID 101091915
7,8-diphenyldibenzo-p-dioxin-2-carbonitrile (PubChem CID 101091915) has the molecular formula C25H15NO2 and a molecular weight of 361.40 g/mol. Its IUPAC name is 7,8-diphenyldibenzo-p-dioxin-2-carbonitrile.
| Compound Name | 7,8-diphenyldibenzo-p-dioxin-2-carbonitrile |
|---|---|
| PubChem CID | 101091915 |
| Molecular Formula | C25H15NO2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 7,8-diphenyldibenzo-p-dioxin-2-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)Oc1cc(-c3ccccc3)c(-c3ccccc3)cc1O2 |
| InChI | InChI=1S/C25H15NO2/c26-16-17-11-12-22-23(13-17)28-25-15-21(19-9-5-2-6-10-19)20(14-24(25)27-22)18-7-3-1-4-8-18/h1-15H |
| InChIKey | XPBCKLYLWSHJJB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |