C18H10N2 — CID 102170033
tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-10-yne-6,15-dicarbonitrile (PubChem CID 102170033) has the molecular formula C18H10N2 and a molecular weight of 254.29 g/mol. Its IUPAC name is tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-10-yne-6,15-dicarbonitrile.
| Compound Name | tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-10-yne-6,15-dicarbonitrile |
|---|---|
| PubChem CID | 102170033 |
| Molecular Formula | C18H10N2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | tricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-10-yne-6,15-dicarbonitrile |
| SMILES | N#Cc1ccc2c(c1)CCc1cc(C#N)ccc1C#C2 |
| InChI | InChI=1S/C18H10N2/c19-11-13-1-3-15-5-6-16-4-2-14(12-20)10-18(16)8-7-17(15)9-13/h1-4,9-10H,7-8H2 |
| InChIKey | KHQILWXGBIAFKE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|