C10H8INO — CID 69199338
1-hydroxy-1-iodo-2,3-dihydroindene-5-carbonitrile (PubChem CID 69199338) has the molecular formula C10H8INO and a molecular weight of 285.08 g/mol. Its IUPAC name is 1-hydroxy-1-iodo-2,3-dihydroindene-5-carbonitrile.
| Compound Name | 1-hydroxy-1-iodo-2,3-dihydroindene-5-carbonitrile |
|---|---|
| PubChem CID | 69199338 |
| Molecular Formula | C10H8INO |
| Molecular Weight | 285.08 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 1-hydroxy-1-iodo-2,3-dihydroindene-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CCC2(O)I |
| InChI | InChI=1S/C10H8INO/c11-10(13)4-3-8-5-7(6-12)1-2-9(8)10/h1-2,5,13H,3-4H2 |
| InChIKey | FPNTXKQZJSLCKS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.08 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|