C26H17N3OS — CID 132562948
2-[(2Z)-2-[[5-(3,4-dihydro-2H-quinolin-1-yl)thiophen-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 132562948) has the molecular formula C26H17N3OS and a molecular weight of 419.51 g/mol. Its IUPAC name is 2-[(2Z)-2-[[5-(3,4-dihydro-2H-quinolin-1-yl)thiophen-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[5-(3,4-dihydro-2H-quinolin-1-yl)thiophen-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 132562948 |
| Molecular Formula | C26H17N3OS |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-[(2Z)-2-[[5-(3,4-dihydro-2H-quinolin-1-yl)thiophen-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C/c2ccc(N3CCCc4ccccc43)s2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H17N3OS/c27-15-18(16-28)25-20-8-2-3-9-21(20)26(30)22(25)14-19-11-12-24(31-19)29-13-5-7-17-6-1-4-10-23(17)29/h1-4,6,8-12,14H,5,7,13H2/b22-14- |
| InChIKey | XOGXELLMSAYTDV-HMAPJEAMSA-N |
| XLogP | 5.91 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|